C22H17N3O4S — CID 17335801
(E)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17335801) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is (E)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17335801 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (E)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(C)c2sc(NC(=O)/C=C/c3ccc(-c4ccccc4[N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C22H17N3O4S/c1-13-7-8-14(2)21-20(13)24-22(30-21)23-19(26)12-10-15-9-11-18(29-15)16-5-3-4-6-17(16)25(27)28/h3-12H,1-2H3,(H,23,24,26)/b12-10+ |
| InChIKey | IMLZESWSAQEOES-ZRDIBKRKSA-N |
| XLogP | 5.73 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|