C27H17Cl3N4O2S — CID 17316366
(E)-N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17316366) has the molecular formula C27H17Cl3N4O2S and a molecular weight of 567.89 g/mol. Its IUPAC name is (E)-N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17316366 |
| Molecular Formula | C27H17Cl3N4O2S |
| Molecular Weight | 567.89 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | (E)-N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C27H17Cl3N4O2S/c28-16-11-15(12-17(29)13-16)24-9-6-19(36-24)7-10-25(35)34-27(37)31-18-5-8-21(30)20(14-18)26-32-22-3-1-2-4-23(22)33-26/h1-14H,(H,32,33)(H2,31,34,35,37)/b10-7+ |
| InChIKey | CTPZWBGALRTVDO-JXMROGBWSA-N |
| XLogP | 7.98 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.89 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|