C27H18Cl2N4O2S — CID 3914568
N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3914568) has the molecular formula C27H18Cl2N4O2S and a molecular weight of 533.44 g/mol. Its IUPAC name is N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3914568 |
| Molecular Formula | C27H18Cl2N4O2S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C27H18Cl2N4O2S/c28-17-7-5-16(6-8-17)24-13-10-19(35-24)11-14-25(34)33-27(36)30-18-9-12-21(29)20(15-18)26-31-22-3-1-2-4-23(22)32-26/h1-15H,(H,31,32)(H2,30,33,34,36) |
| InChIKey | AFZLAOKFOZJBSR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|