C21H13ClFN3O2S2 — CID 4019399
3-[5-(4-chlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 4019399) has the molecular formula C21H13ClFN3O2S2 and a molecular weight of 457.94 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4019399 |
| Molecular Formula | C21H13ClFN3O2S2 |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H13ClFN3O2S2/c22-13-3-1-12(2-4-13)17-9-6-15(28-17)7-10-19(27)25-20(29)26-21-24-16-8-5-14(23)11-18(16)30-21/h1-11H,(H2,24,25,26,27,29) |
| InChIKey | GPHIZBFPIBNIMC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|