C15H10FN3O2S2 — CID 953431
(E)-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 953431) has the molecular formula C15H10FN3O2S2 and a molecular weight of 347.40 g/mol. Its IUPAC name is (E)-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 953431 |
| Molecular Formula | C15H10FN3O2S2 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (E)-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H10FN3O2S2/c16-9-3-5-11-12(8-9)23-15(17-11)19-14(22)18-13(20)6-4-10-2-1-7-21-10/h1-8H,(H2,17,18,19,20,22)/b6-4+ |
| InChIKey | LXDPQEFDSWBAMU-GQCTYLIASA-N |
| XLogP | 3.55 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|