C21H15N3O3S2 — CID 1280303
N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 1280303) has the molecular formula C21H15N3O3S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1280303 |
| Molecular Formula | C21H15N3O3S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)NC(=S)Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H15N3O3S2/c25-17-9-7-13(12-15(17)20-23-16-5-1-2-6-18(16)29-20)22-21(28)24-19(26)10-8-14-4-3-11-27-14/h1-12,25H,(H2,22,24,26,28) |
| InChIKey | DDYZMMHMDBXELV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|