C22H17N3O3S2 — CID 1346800
N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-phenoxyacetamide (PubChem CID 1346800) has the molecular formula C22H17N3O3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 1346800 |
| Molecular Formula | C22H17N3O3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H17N3O3S2/c26-18-11-10-14(12-16(18)21-24-17-8-4-5-9-19(17)30-21)23-22(29)25-20(27)13-28-15-6-2-1-3-7-15/h1-12,26H,13H2,(H2,23,25,27,29) |
| InChIKey | IELMOULOCCNYLE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|