C19H19N3O3S — CID 38999972
N-(6-ethyl-1,3-benzothiazol-2-yl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide (PubChem CID 38999972) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(6-ethyl-1,3-benzothiazol-2-yl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 38999972 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
| SMILES | CCc1ccc2nc(NC(=O)CCNC(=O)/C=C/c3ccco3)sc2c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-2-13-5-7-15-16(12-13)26-19(21-15)22-18(24)9-10-20-17(23)8-6-14-4-3-11-25-14/h3-8,11-12H,2,9-10H2,1H3,(H,20,23)(H,21,22,24)/b8-6+ |
| InChIKey | NYDGNOPCEYQQKZ-SOFGYWHQSA-N |
| XLogP | 3.61 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|