C22H23N3O3S — CID 55615934
3-[3-(furan-2-yl)prop-2-enoylamino]-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]propanamide (PubChem CID 55615934) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]propanamide.
| Compound Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55615934 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]propanamide |
| SMILES | Cc1nc(-c2ccc(CCNC(=O)CCNC(=O)C=Cc3ccco3)cc2)cs1 |
| InChI | InChI=1S/C22H23N3O3S/c1-16-25-20(15-29-16)18-6-4-17(5-7-18)10-12-23-22(27)11-13-24-21(26)9-8-19-3-2-14-28-19/h2-9,14-15H,10-13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OTHGFNFHJGCGSJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|