C21H29N3O2S — CID 51338645
2,2-dimethyl-N-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethylamino]-4-oxobutyl]propanamide (PubChem CID 51338645) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethylamino]-4-oxobutyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethylamino]-4-oxobutyl]propanamide |
|---|---|
| PubChem CID | 51338645 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2,2-dimethyl-N-[4-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethylamino]-4-oxobutyl]propanamide |
| SMILES | Cc1nc(-c2ccc(CCNC(=O)CCCNC(=O)C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C21H29N3O2S/c1-15-24-18(14-27-15)17-9-7-16(8-10-17)11-13-22-19(25)6-5-12-23-20(26)21(2,3)4/h7-10,14H,5-6,11-13H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | MNYJMHLSBXTDMN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|