C19H15F2N3O3S — CID 38999849
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide (PubChem CID 38999849) has the molecular formula C19H15F2N3O3S and a molecular weight of 403.41 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 38999849 |
| Molecular Formula | C19H15F2N3O3S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
| SMILES | O=C(/C=C/c1ccco1)NCCC(=O)Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C19H15F2N3O3S/c20-14-5-3-12(10-15(14)21)16-11-28-19(23-16)24-18(26)7-8-22-17(25)6-4-13-2-1-9-27-13/h1-6,9-11H,7-8H2,(H,22,25)(H,23,24,26)/b6-4+ |
| InChIKey | DBRGXIWYYOHHAQ-GQCTYLIASA-N |
| XLogP | 3.84 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|