C19H16F2N2OS — CID 18268670
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)propanamide (PubChem CID 18268670) has the molecular formula C19H16F2N2OS and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)propanamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 18268670 |
| Molecular Formula | C19H16F2N2OS |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)Nc2nc(-c3ccc(F)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C19H16F2N2OS/c1-12-2-4-13(5-3-12)6-9-18(24)23-19-22-17(11-25-19)14-7-8-15(20)16(21)10-14/h2-5,7-8,10-11H,6,9H2,1H3,(H,22,23,24) |
| InChIKey | FHJSUYVGWJHJRM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |