C15H12N2O2S — CID 6214246
(E)-3-(furan-2-yl)-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide (PubChem CID 6214246) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6214246 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide |
| SMILES | Cc1nc2ccc(NC(=O)/C=C/c3ccco3)cc2s1 |
| InChI | InChI=1S/C15H12N2O2S/c1-10-16-13-6-4-11(9-14(13)20-10)17-15(18)7-5-12-3-2-8-19-12/h2-9H,1H3,(H,17,18)/b7-5+ |
| InChIKey | AARZBJSBECPYDE-FNORWQNLSA-N |
| XLogP | 3.85 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|