C12H11N3OS — CID 108767773
2-cyano-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 108767773) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-cyano-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-cyano-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 108767773 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-cyano-N-(6-ethyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCc1ccc2nc(NC(=O)CC#N)sc2c1 |
| InChI | InChI=1S/C12H11N3OS/c1-2-8-3-4-9-10(7-8)17-12(14-9)15-11(16)5-6-13/h3-4,7H,2,5H2,1H3,(H,14,15,16) |
| InChIKey | OWKYKSZLDOPQMV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |