C14H17ClN2OS — CID 108767769
3-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-2,2-dimethylpropanamide (PubChem CID 108767769) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 3-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 108767769 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-2,2-dimethylpropanamide |
| SMILES | CCc1ccc2nc(NC(=O)C(C)(C)CCl)sc2c1 |
| InChI | InChI=1S/C14H17ClN2OS/c1-4-9-5-6-10-11(7-9)19-13(16-10)17-12(18)14(2,3)8-15/h5-7H,4,8H2,1-3H3,(H,16,17,18) |
| InChIKey | ODCPJXBFKVDMDT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|