C20H28N2OS — CID 108745483
4-butyl-N-(6-ethyl-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 108745483) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is 4-butyl-N-(6-ethyl-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-(6-ethyl-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108745483 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-butyl-N-(6-ethyl-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2nc3ccc(CC)cc3s2)CC1 |
| InChI | InChI=1S/C20H28N2OS/c1-3-5-6-15-7-10-16(11-8-15)19(23)22-20-21-17-12-9-14(4-2)13-18(17)24-20/h9,12-13,15-16H,3-8,10-11H2,1-2H3,(H,21,22,23) |
| InChIKey | IDNCAFJIPQDLSE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |