C18H25N3O3S2 — CID 24603334
N-(6-butyl-1,3-benzothiazol-2-yl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 24603334) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-(6-butyl-1,3-benzothiazol-2-yl)-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(6-butyl-1,3-benzothiazol-2-yl)-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24603334 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(6-butyl-1,3-benzothiazol-2-yl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CCCCc1ccc2nc(NC(=O)C3CCN(S(C)(=O)=O)CC3)sc2c1 |
| InChI | InChI=1S/C18H25N3O3S2/c1-3-4-5-13-6-7-15-16(12-13)25-18(19-15)20-17(22)14-8-10-21(11-9-14)26(2,23)24/h6-7,12,14H,3-5,8-11H2,1-2H3,(H,19,20,22) |
| InChIKey | ZJUOJFMTMWXILY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |