C16H21BrN2OS — CID 17244883
2-bromo-N-(6-butyl-1,3-benzothiazol-2-yl)-3-methylbutanamide (PubChem CID 17244883) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-bromo-N-(6-butyl-1,3-benzothiazol-2-yl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(6-butyl-1,3-benzothiazol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 17244883 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-bromo-N-(6-butyl-1,3-benzothiazol-2-yl)-3-methylbutanamide |
| SMILES | CCCCc1ccc2nc(NC(=O)C(Br)C(C)C)sc2c1 |
| InChI | InChI=1S/C16H21BrN2OS/c1-4-5-6-11-7-8-12-13(9-11)21-16(18-12)19-15(20)14(17)10(2)3/h7-10,14H,4-6H2,1-3H3,(H,18,19,20) |
| InChIKey | JOEFICYGSLNXGE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|