C19H20N2O4S — CID 2452584
N-(6-ethyl-1,3-benzothiazol-2-yl)-2,4,5-trimethoxybenzamide (PubChem CID 2452584) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(6-ethyl-1,3-benzothiazol-2-yl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2452584 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-2,4,5-trimethoxybenzamide |
| SMILES | CCc1ccc2nc(NC(=O)c3cc(OC)c(OC)cc3OC)sc2c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-5-11-6-7-13-17(8-11)26-19(20-13)21-18(22)12-9-15(24-3)16(25-4)10-14(12)23-2/h6-10H,5H2,1-4H3,(H,20,21,22) |
| InChIKey | LRJVVQDLLJOXDE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |