C26H24N2O3S — CID 108767831
(E)-3-(3,4-dimethoxyphenyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)-2-phenylprop-2-enamide (PubChem CID 108767831) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108767831 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethyl-1,3-benzothiazol-2-yl)-2-phenylprop-2-enamide |
| SMILES | CCc1ccc2nc(NC(=O)/C(=C/c3ccc(OC)c(OC)c3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C26H24N2O3S/c1-4-17-10-12-21-24(16-17)32-26(27-21)28-25(29)20(19-8-6-5-7-9-19)14-18-11-13-22(30-2)23(15-18)31-3/h5-16H,4H2,1-3H3,(H,27,28,29)/b20-14+ |
| InChIKey | SBOAPDXYKKGVKR-XSFVSMFZSA-N |
| XLogP | 6.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|