C29H30N2O5S — CID 118296697
N-(6-ethyl-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide (PubChem CID 118296697) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is N-(6-ethyl-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide.
| Compound Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 118296697 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
| SMILES | CCc1ccc2nc(NC(=O)COc3cc(/C=C\c4cc(OC)c(OC)c(OC)c4)ccc3C)sc2c1 |
| InChI | InChI=1S/C29H30N2O5S/c1-6-19-11-12-22-26(16-19)37-29(30-22)31-27(32)17-36-23-13-20(8-7-18(23)2)9-10-21-14-24(33-3)28(35-5)25(15-21)34-4/h7-16H,6,17H2,1-5H3,(H,30,31,32)/b10-9- |
| InChIKey | VPQHPHALJUJXPQ-KTKRTIGZSA-N |
| XLogP | 6.38 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|