C27H24F2N2O5S — CID 118296707
N-(5,6-difluoro-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide (PubChem CID 118296707) has the molecular formula C27H24F2N2O5S and a molecular weight of 526.56 g/mol. Its IUPAC name is N-(5,6-difluoro-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide.
| Compound Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 118296707 |
| Molecular Formula | C27H24F2N2O5S |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)-2-[2-methyl-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C\c2ccc(C)c(OCC(=O)Nc3nc4cc(F)c(F)cc4s3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24F2N2O5S/c1-15-5-6-16(7-8-17-10-22(33-2)26(35-4)23(11-17)34-3)9-21(15)36-14-25(32)31-27-30-20-12-18(28)19(29)13-24(20)37-27/h5-13H,14H2,1-4H3,(H,30,31,32)/b8-7- |
| InChIKey | ASJHFQCRIKEUGL-FPLPWBNLSA-N |
| XLogP | 6.10 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|