C28H25N3O9S — CID 72664813
2-[2-methoxy-5-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]-N-(5-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 72664813) has the molecular formula C28H25N3O9S and a molecular weight of 579.59 g/mol. Its IUPAC name is 2-[2-methoxy-5-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]-N-(5-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[2-methoxy-5-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]-N-(5-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 72664813 |
| Molecular Formula | C28H25N3O9S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 2-[2-methoxy-5-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]-N-(5-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCC(=O)Nc1nc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C28H25N3O9S/c1-36-21-9-6-16(5-8-20(32)17-12-23(37-2)27(39-4)24(13-17)38-3)11-22(21)40-15-26(33)30-28-29-19-14-18(31(34)35)7-10-25(19)41-28/h5-14H,15H2,1-4H3,(H,29,30,33) |
| InChIKey | NPQPXZZFCWVSGY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|