C18H13F2N3O5S — CID 3937813
3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 3937813) has the molecular formula C18H13F2N3O5S and a molecular weight of 421.38 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3937813 |
| Molecular Formula | C18H13F2N3O5S |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)ccc1OC(F)F |
| InChI | InChI=1S/C18H13F2N3O5S/c1-27-14-8-10(2-6-13(14)28-17(19)20)3-7-16(24)22-18-21-12-5-4-11(23(25)26)9-15(12)29-18/h2-9,17H,1H3,(H,21,22,24) |
| InChIKey | CWXLXYKLERBIAO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|