C22H25N3O5S2 — CID 4575832
N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 4575832) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4575832 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)C=Cc3ccc(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C22H25N3O5S2/c1-5-25(6-2)32(27,28)16-9-10-17-20(14-16)31-22(23-17)24-21(26)12-8-15-7-11-18(29-3)19(13-15)30-4/h7-14H,5-6H2,1-4H3,(H,23,24,26) |
| InChIKey | FSUHFFZUUWSJSB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|