C17H13N3O5S — CID 44819486
(E)-3-(3-hydroxy-4-methoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 44819486) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4-methoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 44819486 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-N-(6-nitro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1O |
| InChI | InChI=1S/C17H13N3O5S/c1-25-14-6-2-10(8-13(14)21)3-7-16(22)19-17-18-12-5-4-11(20(23)24)9-15(12)26-17/h2-9,21H,1H3,(H,18,19,22)/b7-3+ |
| InChIKey | LABODZBRBSQHBW-XVNBXDOJSA-N |
| XLogP | 3.57 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|