C16H12ClN3O5S — CID 40614059
N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-2-(4-nitrophenoxy)acetamide (PubChem CID 40614059) has the molecular formula C16H12ClN3O5S and a molecular weight of 393.81 g/mol. Its IUPAC name is N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 40614059 |
| Molecular Formula | C16H12ClN3O5S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-2-(4-nitrophenoxy)acetamide |
| SMILES | COc1cc2sc(NC(=O)COc3ccc([N+](=O)[O-])cc3)nc2cc1Cl |
| InChI | InChI=1S/C16H12ClN3O5S/c1-24-13-7-14-12(6-11(13)17)18-16(26-14)19-15(21)8-25-10-4-2-9(3-5-10)20(22)23/h2-7H,8H2,1H3,(H,18,19,21) |
| InChIKey | SAIZXLPCUDRLMZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|