C13H15ClN2O2S — CID 953037
N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-3-methylbutanamide (PubChem CID 953037) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-3-methylbutanamide.
| Compound Name | N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 953037 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)-3-methylbutanamide |
| SMILES | COc1cc2sc(NC(=O)CC(C)C)nc2cc1Cl |
| InChI | InChI=1S/C13H15ClN2O2S/c1-7(2)4-12(17)16-13-15-9-5-8(14)10(18-3)6-11(9)19-13/h5-7H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | LKTXRVWBVKLAPE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |