C27H26N2O6S — CID 70689136
N-(1,3-benzothiazol-6-yl)-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide (PubChem CID 70689136) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 70689136 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OCC(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C27H26N2O6S/c1-31-21-10-7-17(5-6-18-12-23(32-2)27(34-4)24(13-18)33-3)11-22(21)35-15-26(30)29-19-8-9-20-25(14-19)36-16-28-20/h5-14,16H,15H2,1-4H3,(H,29,30)/b6-5- |
| InChIKey | VJFRMGHPHVTNJN-WAYWQWQTSA-N |
| XLogP | 5.52 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|