C23H18N2O2S — CID 19212134
(E)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2,3-diphenylprop-2-enamide (PubChem CID 19212134) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is (E)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19212134 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (E)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2,3-diphenylprop-2-enamide |
| SMILES | COc1cccc2sc(NC(=O)/C(=C/c3ccccc3)c3ccccc3)nc12 |
| InChI | InChI=1S/C23H18N2O2S/c1-27-19-13-8-14-20-21(19)24-23(28-20)25-22(26)18(17-11-6-3-7-12-17)15-16-9-4-2-5-10-16/h2-15H,1H3,(H,24,25,26)/b18-15+ |
| InChIKey | TZTJUVJHSKNRRX-OBGWFSINSA-N |
| XLogP | 5.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|