C25H23NO6 — CID 108764286
2-[3-[[(E)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enoyl]amino]-4-hydroxyphenyl]acetic acid (PubChem CID 108764286) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-[3-[[(E)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enoyl]amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[[(E)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enoyl]amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 108764286 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[3-[[(E)-3-(3,4-dimethoxyphenyl)-2-phenylprop-2-enoyl]amino]-4-hydroxyphenyl]acetic acid |
| SMILES | COc1ccc(/C=C(/C(=O)Nc2cc(CC(=O)O)ccc2O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H23NO6/c1-31-22-11-9-16(14-23(22)32-2)12-19(18-6-4-3-5-7-18)25(30)26-20-13-17(15-24(28)29)8-10-21(20)27/h3-14,27H,15H2,1-2H3,(H,26,30)(H,28,29)/b19-12+ |
| InChIKey | WHWORKDESPZKLF-XDHOZWIPSA-N |
| XLogP | 4.22 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|