C19H20N2O5 — CID 4925534
2-acetamido-3-(3,4-dimethoxyphenyl)-N-(2-hydroxyphenyl)prop-2-enamide (PubChem CID 4925534) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-acetamido-3-(3,4-dimethoxyphenyl)-N-(2-hydroxyphenyl)prop-2-enamide.
| Compound Name | 2-acetamido-3-(3,4-dimethoxyphenyl)-N-(2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4925534 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-acetamido-3-(3,4-dimethoxyphenyl)-N-(2-hydroxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=C(NC(C)=O)C(=O)Nc2ccccc2O)cc1OC |
| InChI | InChI=1S/C19H20N2O5/c1-12(22)20-15(19(24)21-14-6-4-5-7-16(14)23)10-13-8-9-17(25-2)18(11-13)26-3/h4-11,23H,1-3H3,(H,20,22)(H,21,24) |
| InChIKey | NFXOGHVNGXCKPR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|