C21H24N2O4 — CID 23013597
(Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)prop-2-enamide (PubChem CID 23013597) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 23013597 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(\NC(C)=O)C(=O)Nc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C21H24N2O4/c1-13-8-14(2)10-17(9-13)23-21(25)18(22-15(3)24)11-16-6-7-19(26-4)20(12-16)27-5/h6-12H,1-5H3,(H,22,24)(H,23,25)/b18-11- |
| InChIKey | YXPROICZQOOVOZ-WQRHYEAKSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|