C23H28N2O5 — CID 18860017
N-[(E)-1-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18860017) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18860017 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[(E)-1-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccccc1NC(=O)/C(=C\c1ccc(OC)c(OC)c1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H28N2O5/c1-23(2,3)22(27)25-17(13-15-11-12-19(29-5)20(14-15)30-6)21(26)24-16-9-7-8-10-18(16)28-4/h7-14H,1-6H3,(H,24,26)(H,25,27)/b17-13+ |
| InChIKey | IUAPJFBRNMSHMM-GHRIWEEISA-N |
| XLogP | 3.85 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|