C26H22N2O6S — CID 155814541
(E)-3-(1,3-benzodioxol-5-yl)-2-(3,4-dimethoxyphenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 155814541) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-(3,4-dimethoxyphenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(3,4-dimethoxyphenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155814541 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(3,4-dimethoxyphenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc2nc(NC(=O)/C(=C/c3ccc4c(c3)OCO4)c3ccc(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C26H22N2O6S/c1-30-17-6-7-19-24(13-17)35-26(27-19)28-25(29)18(16-5-9-20(31-2)22(12-16)32-3)10-15-4-8-21-23(11-15)34-14-33-21/h4-13H,14H2,1-3H3,(H,27,28,29)/b18-10+ |
| InChIKey | UAJDCDNICJFUDI-VCHYOVAHSA-N |
| XLogP | 5.23 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|