C30H23FN2O2S — CID 2355881
(E)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)-2-(4-phenylphenyl)prop-2-enamide (PubChem CID 2355881) has the molecular formula C30H23FN2O2S and a molecular weight of 494.59 g/mol. Its IUPAC name is (E)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)-2-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)-2-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2355881 |
| Molecular Formula | C30H23FN2O2S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (E)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)-2-(4-phenylphenyl)prop-2-enamide |
| SMILES | CCOc1ccc2nc(NC(=O)/C(=C/c3ccc(F)cc3)c3ccc(-c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C30H23FN2O2S/c1-2-35-25-16-17-27-28(19-25)36-30(32-27)33-29(34)26(18-20-8-14-24(31)15-9-20)23-12-10-22(11-13-23)21-6-4-3-5-7-21/h3-19H,2H2,1H3,(H,32,33,34)/b26-18+ |
| InChIKey | ULNMSNKJNQLSDB-NLRVBDNBSA-N |
| XLogP | 7.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|