C20H16N2O2S2 — CID 18274982
N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-phenylthiophene-2-carboxamide (PubChem CID 18274982) has the molecular formula C20H16N2O2S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-phenylthiophene-2-carboxamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18274982 |
| Molecular Formula | C20H16N2O2S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-phenylthiophene-2-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3sccc3-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C20H16N2O2S2/c1-2-24-14-8-9-16-17(12-14)26-20(21-16)22-19(23)18-15(10-11-25-18)13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,21,22,23) |
| InChIKey | CLDDJCPBCGHTJF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |