C17H15FN2O2S — CID 110825428
2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-fluorophenyl)ethanone (PubChem CID 110825428) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110825428 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-(4-fluorophenyl)ethanone |
| SMILES | CCOc1ccc2nc(NCC(=O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C17H15FN2O2S/c1-2-22-13-7-8-14-16(9-13)23-17(20-14)19-10-15(21)11-3-5-12(18)6-4-11/h3-9H,2,10H2,1H3,(H,19,20) |
| InChIKey | HHMSSVMPWCOXET-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |