C14H19N3O2S — CID 79518268
2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-N-propylacetamide (PubChem CID 79518268) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-N-propylacetamide.
| Compound Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 79518268 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1nc2ccc(OCC)cc2s1 |
| InChI | InChI=1S/C14H19N3O2S/c1-3-7-15-13(18)9-16-14-17-11-6-5-10(19-4-2)8-12(11)20-14/h5-6,8H,3-4,7,9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | YQYDNZOKQOPODI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |