C12H17N3OS — CID 82191696
N'-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1,3-diamine (PubChem CID 82191696) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is N'-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1,3-diamine.
| Compound Name | N'-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82191696 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N'-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1,3-diamine |
| SMILES | CCOc1ccc2nc(NCCCN)sc2c1 |
| InChI | InChI=1S/C12H17N3OS/c1-2-16-9-4-5-10-11(8-9)17-12(15-10)14-7-3-6-13/h4-5,8H,2-3,6-7,13H2,1H3,(H,14,15) |
| InChIKey | BBIFZTDDPQRBDU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|