C18H15F2N3O5S — CID 24572776
4-(difluoromethoxy)-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide (PubChem CID 24572776) has the molecular formula C18H15F2N3O5S and a molecular weight of 423.40 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide.
| Compound Name | 4-(difluoromethoxy)-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 24572776 |
| Molecular Formula | C18H15F2N3O5S |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 4-(difluoromethoxy)-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide |
| SMILES | CCc1ccc2nc(NC(=O)c3cc(OC)c(OC(F)F)cc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C18H15F2N3O5S/c1-3-9-4-5-11-15(6-9)29-18(21-11)22-16(24)10-7-13(27-2)14(28-17(19)20)8-12(10)23(25)26/h4-8,17H,3H2,1-2H3,(H,21,22,24) |
| InChIKey | UZDMOCRPSLFOLX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|