C19H19N3O6S — CID 8928038
4-ethoxy-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide (PubChem CID 8928038) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-ethoxy-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide.
| Compound Name | 4-ethoxy-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 8928038 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-ethoxy-N-(6-ethoxy-1,3-benzothiazol-2-yl)-5-methoxy-2-nitrobenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3cc(OC)c(OCC)cc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H19N3O6S/c1-4-27-11-6-7-13-17(8-11)29-19(20-13)21-18(23)12-9-15(26-3)16(28-5-2)10-14(12)22(24)25/h6-10H,4-5H2,1-3H3,(H,20,21,23) |
| InChIKey | OLAANLATSAKHHX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|