C20H18ClN3O3S — CID 8582396
N-(6-chloro-1,3-benzothiazol-2-yl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide (PubChem CID 8582396) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 8582396 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCC(=O)Nc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-27-15-6-2-13(3-7-15)4-9-18(25)22-11-10-19(26)24-20-23-16-8-5-14(21)12-17(16)28-20/h2-9,12H,10-11H2,1H3,(H,22,25)(H,23,24,26)/b9-4+ |
| InChIKey | MZCMLIDSDZIFOS-RUDMXATFSA-N |
| XLogP | 4.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|