C19H18ClFN2O3 — CID 9097418
N-(4-chloro-2-fluorophenyl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide (PubChem CID 9097418) has the molecular formula C19H18ClFN2O3 and a molecular weight of 376.82 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 9097418 |
| Molecular Formula | C19H18ClFN2O3 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCC(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H18ClFN2O3/c1-26-15-6-2-13(3-7-15)4-9-18(24)22-11-10-19(25)23-17-8-5-14(20)12-16(17)21/h2-9,12H,10-11H2,1H3,(H,22,24)(H,23,25)/b9-4+ |
| InChIKey | ZTQHIKGGYGDLOZ-RUDMXATFSA-N |
| XLogP | 3.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|