C13H8FN3O2S2 — CID 953520
N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 953520) has the molecular formula C13H8FN3O2S2 and a molecular weight of 321.36 g/mol. Its IUPAC name is N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 953520 |
| Molecular Formula | C13H8FN3O2S2 |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc(F)cc2s1)c1ccco1 |
| InChI | InChI=1S/C13H8FN3O2S2/c14-7-3-4-8-10(6-7)21-13(15-8)17-12(20)16-11(18)9-2-1-5-19-9/h1-6H,(H2,15,16,17,18,20) |
| InChIKey | DSTMSXKDEMRUHP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|