C15H8Cl2FN3OS2 — CID 1391844
2,4-dichloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 1391844) has the molecular formula C15H8Cl2FN3OS2 and a molecular weight of 400.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1391844 |
| Molecular Formula | C15H8Cl2FN3OS2 |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 2,4-dichloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc(F)cc2s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2FN3OS2/c16-7-1-3-9(10(17)5-7)13(22)20-14(23)21-15-19-11-4-2-8(18)6-12(11)24-15/h1-6H,(H2,19,20,21,22,23) |
| InChIKey | IPQMLACMHFBTLG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|