C17H10Cl2N4OS4 — CID 90601822
2,4-dichloro-N-[(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)carbamothioyl]benzamide (PubChem CID 90601822) has the molecular formula C17H10Cl2N4OS4 and a molecular weight of 485.47 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90601822 |
| Molecular Formula | C17H10Cl2N4OS4 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | 2,4-dichloro-N-[(2-methylsulfanyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-7-yl)carbamothioyl]benzamide |
| SMILES | CSc1nc2ccc3nc(NC(=S)NC(=O)c4ccc(Cl)cc4Cl)sc3c2s1 |
| InChI | InChI=1S/C17H10Cl2N4OS4/c1-26-17-21-11-5-4-10-12(13(11)28-17)27-16(20-10)23-15(25)22-14(24)8-3-2-7(18)6-9(8)19/h2-6H,1H3,(H2,20,22,23,24,25) |
| InChIKey | QNWGMUODNCMDQV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|