C19H13BrCl2N2O2 — CID 3632284
N-(5-bromo-6-methyl-2-pyridinyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3632284) has the molecular formula C19H13BrCl2N2O2 and a molecular weight of 452.14 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3632284 |
| Molecular Formula | C19H13BrCl2N2O2 |
| Molecular Weight | 452.14 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1nc(NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)ccc1Br |
| InChI | InChI=1S/C19H13BrCl2N2O2/c1-11-14(20)7-9-17(23-11)24-18(25)10-6-12-5-8-16(26-12)13-3-2-4-15(21)19(13)22/h2-10H,1H3,(H,23,24,25) |
| InChIKey | KJDLSCDRZXXANO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.14 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|