C23H16Cl2N2O2 — CID 17313821
(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(2-methylquinolin-5-yl)prop-2-enamide (PubChem CID 17313821) has the molecular formula C23H16Cl2N2O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(2-methylquinolin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(2-methylquinolin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17313821 |
| Molecular Formula | C23H16Cl2N2O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(2-methylquinolin-5-yl)prop-2-enamide |
| SMILES | Cc1ccc2c(NC(=O)/C=C/c3ccc(-c4cccc(Cl)c4Cl)o3)cccc2n1 |
| InChI | InChI=1S/C23H16Cl2N2O2/c1-14-8-11-16-19(26-14)6-3-7-20(16)27-22(28)13-10-15-9-12-21(29-15)17-4-2-5-18(24)23(17)25/h2-13H,1H3,(H,27,28)/b13-10+ |
| InChIKey | RJIAXMONQUBPMC-JLHYYAGUSA-N |
| XLogP | 6.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|