C15H12BrClN2O — CID 6134268
(E)-N-(5-bromo-6-methyl-2-pyridinyl)-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 6134268) has the molecular formula C15H12BrClN2O and a molecular weight of 351.63 g/mol. Its IUPAC name is (E)-N-(5-bromo-6-methyl-2-pyridinyl)-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-bromo-6-methyl-2-pyridinyl)-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6134268 |
| Molecular Formula | C15H12BrClN2O |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | (E)-N-(5-bromo-6-methyl-2-pyridinyl)-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | Cc1nc(NC(=O)/C=C/c2ccc(Cl)cc2)ccc1Br |
| InChI | InChI=1S/C15H12BrClN2O/c1-10-13(16)7-8-14(18-10)19-15(20)9-4-11-2-5-12(17)6-3-11/h2-9H,1H3,(H,18,19,20)/b9-4+ |
| InChIKey | ZGEQLIWUAZPAQB-RUDMXATFSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|